C28H36N2O7 — CID 11092462
[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[cyano(phenyl)methyl]-methylamino]-4-oxobutanoate (PubChem CID 11092462) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[cyano(phenyl)methyl]-methylamino]-4-oxobutanoate.
| Compound Name | [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[cyano(phenyl)methyl]-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 11092462 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[cyano(phenyl)methyl]-methylamino]-4-oxobutanoate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)N(C)C(C#N)c3ccccc3)O[C@@H]3O[C@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C28H36N2O7/c1-17-10-11-21-18(2)25(34-26-28(21)20(17)14-15-27(3,35-26)36-37-28)33-24(32)13-12-23(31)30(4)22(16-29)19-8-6-5-7-9-19/h5-9,17-18,20-22,25-26H,10-15H2,1-4H3/t17-,18-,20?,21?,22?,25-,26-,27+,28-/m1/s1 |
| InChIKey | BLYPAAKYLIXBEU-XKINSVADSA-N |
| XLogP | 4.24 |
| TPSA | 107.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|