C28H37NO10 — CID 95373999
(2S,3S)-3-hydroxy-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]-3-phenylpropanoic acid (PubChem CID 95373999) has the molecular formula C28H37NO10 and a molecular weight of 547.60 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 95373999 |
| Molecular Formula | C28H37NO10 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)N[C@H](C(=O)O)[C@@H](O)c2ccccc2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C28H37NO10/c1-15-9-10-19-16(2)25(36-26-28(19)18(15)13-14-27(3,37-26)38-39-28)35-21(31)12-11-20(30)29-22(24(33)34)23(32)17-7-5-4-6-8-17/h4-8,15-16,18-19,22-23,25-26,32H,9-14H2,1-3H3,(H,29,30)(H,33,34)/t15-,16-,18+,19+,22+,23+,25-,26-,27-,28-/m1/s1 |
| InChIKey | NQQTYPVPNXLGIQ-UPITVEGHSA-N |
| XLogP | 2.82 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|