C23H34N2O10 — CID 95374300
(2S)-4-amino-4-oxo-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid (PubChem CID 95374300) has the molecular formula C23H34N2O10 and a molecular weight of 498.53 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 95374300 |
| Molecular Formula | C23H34N2O10 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)N[C@@H](CC(N)=O)C(=O)O)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C23H34N2O10/c1-11-4-5-14-12(2)20(32-21-23(14)13(11)8-9-22(3,33-21)34-35-23)31-18(28)7-6-17(27)25-15(19(29)30)10-16(24)26/h11-15,20-21H,4-10H2,1-3H3,(H2,24,26)(H,25,27)(H,29,30)/t11-,12-,13+,14+,15+,20-,21-,22-,23-/m1/s1 |
| InChIKey | ZRIHHCCGRCSDSV-MQZYIPKXSA-N |
| XLogP | 0.96 |
| TPSA | 172.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|