C24H35NO11 — CID 98139417
(2S)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]pentanedioic acid (PubChem CID 98139417) has the molecular formula C24H35NO11 and a molecular weight of 513.54 g/mol. Its IUPAC name is (2S)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 98139417 |
| Molecular Formula | C24H35NO11 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (2S)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]pentanedioic acid |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C24H35NO11/c1-12-4-5-15-13(2)21(33-22-24(15)14(12)10-11-23(3,34-22)35-36-24)32-19(29)9-7-17(26)25-16(20(30)31)6-8-18(27)28/h12-16,21-22H,4-11H2,1-3H3,(H,25,26)(H,27,28)(H,30,31)/t12-,13-,14+,15+,16+,21-,22-,23+,24-/m1/s1 |
| InChIKey | KBMWSQFYOSGIPO-WDRPUIATSA-N |
| XLogP | 1.95 |
| TPSA | 166.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|