C23H37NO7 — CID 98122549
[(1R,4S,5R,8S,9R,10R,12S,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[(2S)-butan-2-yl]amino]-4-oxobutanoate (PubChem CID 98122549) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R,10R,12S,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[(2S)-butan-2-yl]amino]-4-oxobutanoate.
| Compound Name | [(1R,4S,5R,8S,9R,10R,12S,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[(2S)-butan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 98122549 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | [(1R,4S,5R,8S,9R,10R,12S,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[(2S)-butan-2-yl]amino]-4-oxobutanoate |
| SMILES | CC[C@H](C)NC(=O)CCC(=O)O[C@H]1O[C@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]24OO3 |
| InChI | InChI=1S/C23H37NO7/c1-6-14(3)24-18(25)9-10-19(26)27-20-15(4)17-8-7-13(2)16-11-12-22(5)29-21(28-20)23(16,17)31-30-22/h13-17,20-21H,6-12H2,1-5H3,(H,24,25)/t13-,14+,15-,16+,17+,20+,21+,22-,23+/m1/s1 |
| InChIKey | LLEYTMCHSAVWTC-ALWNYJPQSA-N |
| XLogP | 3.43 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|