C27H37NO7 — CID 44713105
[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(1-phenylethylamino)butanoate (PubChem CID 44713105) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(1-phenylethylamino)butanoate.
| Compound Name | [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(1-phenylethylamino)butanoate |
|---|---|
| PubChem CID | 44713105 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(1-phenylethylamino)butanoate |
| SMILES | CC(NC(=O)CCC(=O)O[C@@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CCC([C@H]1C)C24OO3)c1ccccc1 |
| InChI | InChI=1S/C27H37NO7/c1-16-10-11-21-17(2)24(32-25-27(21)20(16)14-15-26(4,33-25)34-35-27)31-23(30)13-12-22(29)28-18(3)19-8-6-5-7-9-19/h5-9,16-18,20-21,24-25H,10-15H2,1-4H3,(H,28,29)/t16-,17-,18?,20+,21?,24-,25-,26+,27?/m1/s1 |
| InChIKey | ALHVKKXRLZRWRF-UKHDSBAHSA-N |
| XLogP | 4.40 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|