C24H37NO9S — CID 95371793
(2R)-4-methylsulfanyl-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid (PubChem CID 95371793) has the molecular formula C24H37NO9S and a molecular weight of 515.63 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 95371793 |
| Molecular Formula | C24H37NO9S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[[4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CCC(=O)O[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)C(=O)O |
| InChI | InChI=1S/C24H37NO9S/c1-13-5-6-16-14(2)21(31-22-24(16)15(13)9-11-23(3,32-22)33-34-24)30-19(27)8-7-18(26)25-17(20(28)29)10-12-35-4/h13-17,21-22H,5-12H2,1-4H3,(H,25,26)(H,28,29)/t13-,14-,15+,16+,17-,21-,22-,23-,24-/m1/s1 |
| InChIKey | AZFUPQMDKQZSAV-WNYUMUMXSA-N |
| XLogP | 2.84 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|