C31H44N2O7 — CID 99934312
[(1S,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-oxobutanoate (PubChem CID 99934312) has the molecular formula C31H44N2O7 and a molecular weight of 556.70 g/mol. Its IUPAC name is [(1S,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-oxobutanoate.
| Compound Name | [(1S,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 99934312 |
| Molecular Formula | C31H44N2O7 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | [(1S,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-oxobutanoate |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)CCC(=O)O[C@@H]3O[C@@H]4O[C@]5(C)CC[C@H]6[C@H](C)CC[C@H]([C@H]3C)[C@@]46OO5)CC2)c1 |
| InChI | InChI=1S/C31H44N2O7/c1-19-6-7-21(3)25(18-19)32-14-16-33(17-15-32)26(34)10-11-27(35)36-28-22(4)24-9-8-20(2)23-12-13-30(5)38-29(37-28)31(23,24)40-39-30/h6-7,18,20,22-24,28-29H,8-17H2,1-5H3/t20-,22-,23+,24-,28-,29-,30+,31-/m1/s1 |
| InChIKey | IUZNRCKFBVQXRE-JKNYSGLQSA-N |
| XLogP | 4.48 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|