C26H41NO7 — CID 126505015
[(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(cyclohexylmethylamino)-4-oxobutanoate (PubChem CID 126505015) has the molecular formula C26H41NO7 and a molecular weight of 479.61 g/mol. Its IUPAC name is [(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(cyclohexylmethylamino)-4-oxobutanoate.
| Compound Name | [(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(cyclohexylmethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 126505015 |
| Molecular Formula | C26H41NO7 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | [(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(cyclohexylmethylamino)-4-oxobutanoate |
| SMILES | CC1CCC2C(C)[C@H](OC(=O)CCC(=O)NCC3CCCCC3)O[C@@H]3O[C@@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C26H41NO7/c1-16-9-10-20-17(2)23(31-24-26(20)19(16)13-14-25(3,32-24)33-34-26)30-22(29)12-11-21(28)27-15-18-7-5-4-6-8-18/h16-20,23-24H,4-15H2,1-3H3,(H,27,28)/t16?,17?,19?,20?,23-,24-,25-,26-/m1/s1 |
| InChIKey | YTHIOLCNKYTWGD-CCTNANFVSA-N |
| XLogP | 4.21 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|