C24H37NO8 — CID 44713143
[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(oxolan-2-ylmethylamino)butanoate (PubChem CID 44713143) has the molecular formula C24H37NO8 and a molecular weight of 467.56 g/mol. Its IUPAC name is [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(oxolan-2-ylmethylamino)butanoate.
| Compound Name | [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(oxolan-2-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 44713143 |
| Molecular Formula | C24H37NO8 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | [(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(oxolan-2-ylmethylamino)butanoate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)NCC3CCCO3)O[C@@H]3O[C@]4(C)CC[C@@H]1C23OO4 |
| InChI | InChI=1S/C24H37NO8/c1-14-6-7-18-15(2)21(29-20(27)9-8-19(26)25-13-16-5-4-12-28-16)30-22-24(18)17(14)10-11-23(3,31-22)32-33-24/h14-18,21-22H,4-13H2,1-3H3,(H,25,26)/t14-,15-,16?,17+,18?,21-,22-,23+,24?/m1/s1 |
| InChIKey | FGAZIYTVJQSGPZ-HIFOEAKJSA-N |
| XLogP | 2.81 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|