C23H37NO9 — CID 95372701
[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(2,2-dimethoxyethylamino)-4-oxobutanoate (PubChem CID 95372701) has the molecular formula C23H37NO9 and a molecular weight of 471.55 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(2,2-dimethoxyethylamino)-4-oxobutanoate.
| Compound Name | [(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(2,2-dimethoxyethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 95372701 |
| Molecular Formula | C23H37NO9 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(2,2-dimethoxyethylamino)-4-oxobutanoate |
| SMILES | COC(CNC(=O)CCC(=O)O[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)OC |
| InChI | InChI=1S/C23H37NO9/c1-13-6-7-16-14(2)20(29-18(26)9-8-17(25)24-12-19(27-4)28-5)30-21-23(16)15(13)10-11-22(3,31-21)32-33-23/h13-16,19-21H,6-12H2,1-5H3,(H,24,25)/t13-,14-,15+,16+,20-,21-,22-,23-/m1/s1 |
| InChIKey | LSOOKZNJSRIBDY-VGWUIMAISA-N |
| XLogP | 2.25 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|