C31H42N2O9 — CID 124917892
[(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-oxobutanoate (PubChem CID 124917892) has the molecular formula C31H42N2O9 and a molecular weight of 586.68 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-oxobutanoate.
| Compound Name | [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 124917892 |
| Molecular Formula | C31H42N2O9 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-oxobutanoate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C31H42N2O9/c1-19-4-6-23-20(2)28(39-29-31(23)22(19)10-11-30(3,40-29)41-42-31)38-27(35)9-8-26(34)33-14-12-32(13-15-33)17-21-5-7-24-25(16-21)37-18-36-24/h5,7,16,19-20,22-23,28-29H,4,6,8-15,17-18H2,1-3H3/t19-,20-,22-,23-,28-,29-,30-,31-/m1/s1 |
| InChIKey | UZEOVNLCUPRZCB-DBVVXOJGSA-N |
| XLogP | 3.59 |
| TPSA | 105.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|