C25H34N2O7 — CID 124917887
[(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(pyridin-3-ylmethylamino)butanoate (PubChem CID 124917887) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(pyridin-3-ylmethylamino)butanoate.
| Compound Name | [(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(pyridin-3-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 124917887 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(pyridin-3-ylmethylamino)butanoate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)NCc2cccnc2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H34N2O7/c1-15-6-7-19-16(2)22(31-23-25(19)18(15)10-11-24(3,32-23)33-34-25)30-21(29)9-8-20(28)27-14-17-5-4-12-26-13-17/h4-5,12-13,15-16,18-19,22-23H,6-11,14H2,1-3H3,(H,27,28)/t15-,16-,18+,19-,22-,23-,24-,25-/m1/s1 |
| InChIKey | RBFGASJFBHLRGG-YRARTXOMSA-N |
| XLogP | 3.23 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|