C24H31NO8 — CID 177430676
(3R)-3-(4-nitrophenyl)-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoic acid (PubChem CID 177430676) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is (3R)-3-(4-nitrophenyl)-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoic acid.
| Compound Name | (3R)-3-(4-nitrophenyl)-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoic acid |
|---|---|
| PubChem CID | 177430676 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (3R)-3-(4-nitrophenyl)-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoic acid |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H]([C@H](CC(=O)O)c3ccc([N+](=O)[O-])cc3)O[C@@H]3O[C@@]4(C)CC[C@@H]1C23OO4 |
| InChI | InChI=1S/C24H31NO8/c1-13-4-9-19-14(2)21(17(12-20(26)27)15-5-7-16(8-6-15)25(28)29)30-22-24(19)18(13)10-11-23(3,31-22)32-33-24/h5-8,13-14,17-19,21-22H,4,9-12H2,1-3H3,(H,26,27)/t13-,14-,17-,18+,19?,21+,22-,23-,24?/m1/s1 |
| InChIKey | AGTMBXVQXWKZHM-UHHLURCVSA-N |
| XLogP | 4.40 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|