C19H30O6 — CID 73349718
4-[(1S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanoic acid (PubChem CID 73349718) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-[(1S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanoic acid.
| Compound Name | 4-[(1S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanoic acid |
|---|---|
| PubChem CID | 73349718 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-[(1S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanoic acid |
| SMILES | C[C@H]1[C@@H](CCCC(=O)O)O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]1[C@]42OO3 |
| InChI | InChI=1S/C19H30O6/c1-11-7-8-14-12(2)15(5-4-6-16(20)21)22-17-19(14)13(11)9-10-18(3,23-17)24-25-19/h11-15,17H,4-10H2,1-3H3,(H,20,21)/t11-,12-,13?,14+,15-,17-,18+,19-/m1/s1 |
| InChIKey | WEWYKNVABULCLM-ZGPPLRIESA-N |
| XLogP | 3.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|