C20H34O4 — CID 164938700
(4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-(3-methylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 164938700) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-(3-methylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-(3-methylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 164938700 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-(3-methylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CC(C)CCC1O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C20H34O4/c1-12(2)6-9-17-14(4)16-8-7-13(3)15-10-11-19(5)22-18(21-17)20(15,16)24-23-19/h12-18H,6-11H2,1-5H3/t13-,14-,15+,16+,17?,18-,19?,20-/m1/s1 |
| InChIKey | QXCFGYIWNPIPCZ-RAQQDQNBSA-N |
| XLogP | 4.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|