C18H28O4 — CID 10881394
(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-prop-2-enyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10881394) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-prop-2-enyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-prop-2-enyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10881394 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-prop-2-enyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C=CC[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C18H28O4/c1-5-6-15-12(3)14-8-7-11(2)13-9-10-17(4)20-16(19-15)18(13,14)22-21-17/h5,11-16H,1,6-10H2,2-4H3/t11-,12-,13+,14+,15-,16-,17-,18-/m1/s1 |
| InChIKey | KEZLGTVQHVUUNM-VMAIWCPRSA-N |
| XLogP | 3.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|