C20H29NO5 — CID 53329655
(3S)-3-hydroxy-2-methylidene-4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanenitrile (PubChem CID 53329655) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is (3S)-3-hydroxy-2-methylidene-4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanenitrile.
| Compound Name | (3S)-3-hydroxy-2-methylidene-4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanenitrile |
|---|---|
| PubChem CID | 53329655 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (3S)-3-hydroxy-2-methylidene-4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]butanenitrile |
| SMILES | C=C(C#N)[C@@H](O)C[C@H]1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)C42OO3 |
| InChI | InChI=1S/C20H29NO5/c1-11-5-6-15-13(3)17(9-16(22)12(2)10-21)23-18-20(15)14(11)7-8-19(4,24-18)25-26-20/h11,13-18,22H,2,5-9H2,1,3-4H3/t11-,13-,14?,15+,16+,17-,18-,19+,20?/m1/s1 |
| InChIKey | RZGGXGIICUEADL-AKUDOVSBSA-N |
| XLogP | 3.07 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|