C19H32O4 — CID 10448944
(1S,5R,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10448944) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (1S,5R,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10448944 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (1S,5R,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CCCC[C@H]1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CCC([C@H]1C)[C@]42OO3 |
| InChI | InChI=1S/C19H32O4/c1-5-6-7-16-13(3)15-9-8-12(2)14-10-11-18(4)21-17(20-16)19(14,15)23-22-18/h12-17H,5-11H2,1-4H3/t12-,13-,14?,15?,16-,17-,18+,19-/m1/s1 |
| InChIKey | NCRPMFJIMMDUKN-IGATZKROSA-N |
| XLogP | 4.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|