C19H32O3 — CID 59274598
(1R,4S,5R,8S,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane (PubChem CID 59274598) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
|---|---|
| PubChem CID | 59274598 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-10-butyl-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
| SMILES | CCCC[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24O3 |
| InChI | InChI=1S/C19H32O3/c1-5-6-7-16-13(3)15-9-8-12(2)14-10-11-18(4)21-17(20-16)19(14,15)22-18/h12-17H,5-11H2,1-4H3/t12-,13-,14+,15+,16-,17-,18+,19-/m1/s1 |
| InChIKey | KDVNUDBGEAKLMX-XSIWTTSSSA-N |
| XLogP | 4.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |