C26H36O7 — CID 10479373
ethyl (3R)-3-phenyl-3-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate (PubChem CID 10479373) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl (3R)-3-phenyl-3-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate.
| Compound Name | ethyl (3R)-3-phenyl-3-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate |
|---|---|
| PubChem CID | 10479373 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | ethyl (3R)-3-phenyl-3-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate |
| SMILES | CCOC(=O)C[C@@H](O[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CCC([C@H]1C)[C@@]24OO3)c1ccccc1 |
| InChI | InChI=1S/C26H36O7/c1-5-28-22(27)15-21(18-9-7-6-8-10-18)29-23-17(3)20-12-11-16(2)19-13-14-25(4)31-24(30-23)26(19,20)33-32-25/h6-10,16-17,19-21,23-24H,5,11-15H2,1-4H3/t16-,17-,19+,20?,21-,23+,24-,25-,26-/m1/s1 |
| InChIKey | FPEQFAHPKQUFAG-CIYIZRMJSA-N |
| XLogP | 4.91 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|