C24H34N4O5S — CID 71500370
6-[3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propoxymethyl]tetrazolo[1,5-a]pyridine (PubChem CID 71500370) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is 6-[3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propoxymethyl]tetrazolo[1,5-a]pyridine.
| Compound Name | 6-[3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propoxymethyl]tetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 71500370 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6-[3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propoxymethyl]tetrazolo[1,5-a]pyridine |
| SMILES | C[C@H]1[C@H](SCCCOCc2ccc3nnnn3c2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C24H34N4O5S/c1-15-5-7-19-16(2)21(30-22-24(19)18(15)9-10-23(3,31-22)32-33-24)34-12-4-11-29-14-17-6-8-20-25-26-27-28(20)13-17/h6,8,13,15-16,18-19,21-22H,4-5,7,9-12,14H2,1-3H3/t15-,16-,18+,19+,21+,22-,23-,24-/m1/s1 |
| InChIKey | ZCCGNQIOHZBHNJ-JWLLMUSHSA-N |
| XLogP | 3.97 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|