C24H41NO6S — CID 140665298
2-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]ethyl N,N-di(propan-2-yl)carbamate (PubChem CID 140665298) has the molecular formula C24H41NO6S and a molecular weight of 471.66 g/mol. Its IUPAC name is 2-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]ethyl N,N-di(propan-2-yl)carbamate.
| Compound Name | 2-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]ethyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 140665298 |
| Molecular Formula | C24H41NO6S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]ethyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OCCS[C@@H]1O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)C(C)C |
| InChI | InChI=1S/C24H41NO6S/c1-14(2)25(15(3)4)22(26)27-12-13-32-20-17(6)19-9-8-16(5)18-10-11-23(7)29-21(28-20)24(18,19)31-30-23/h14-21H,8-13H2,1-7H3/t16-,17-,18+,19+,20+,21-,23?,24-/m1/s1 |
| InChIKey | JQFUCBDZXHVWIM-GBWFJLMMSA-N |
| XLogP | 5.18 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|