C23H38O6S2 — CID 66545957
3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl tert-butylsulfanylformate (PubChem CID 66545957) has the molecular formula C23H38O6S2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl tert-butylsulfanylformate.
| Compound Name | 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl tert-butylsulfanylformate |
|---|---|
| PubChem CID | 66545957 |
| Molecular Formula | C23H38O6S2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl tert-butylsulfanylformate |
| SMILES | C[C@H]1[C@H](SCCCOC(=O)SC(C)(C)C)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C23H38O6S2/c1-14-8-9-17-15(2)18(30-13-7-12-25-20(24)31-21(3,4)5)26-19-23(17)16(14)10-11-22(6,27-19)28-29-23/h14-19H,7-13H2,1-6H3/t14-,15-,16+,17+,18+,19-,22-,23-/m1/s1 |
| InChIKey | JFKWCHFMQMJRKX-UDOCLWLFSA-N |
| XLogP | 5.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|