C19H30O6S — CID 71737207
methyl 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanoate (PubChem CID 71737207) has the molecular formula C19H30O6S and a molecular weight of 386.51 g/mol. Its IUPAC name is methyl 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanoate.
| Compound Name | methyl 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 71737207 |
| Molecular Formula | C19H30O6S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | methyl 3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanoate |
| SMILES | COC(=O)CCS[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C19H30O6S/c1-11-5-6-14-12(2)16(26-10-8-15(20)21-4)22-17-19(14)13(11)7-9-18(3,23-17)24-25-19/h11-14,16-17H,5-10H2,1-4H3/t11-,12-,13+,14+,16+,17-,18-,19-/m1/s1 |
| InChIKey | QHDNMZKFRBAFFZ-LKQXGUGWSA-N |
| XLogP | 3.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|