C24H32FNO5S — CID 71737204
N-(4-fluorophenyl)-3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanamide (PubChem CID 71737204) has the molecular formula C24H32FNO5S and a molecular weight of 465.59 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanamide.
| Compound Name | N-(4-fluorophenyl)-3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 71737204 |
| Molecular Formula | C24H32FNO5S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-(4-fluorophenyl)-3-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propanamide |
| SMILES | C[C@H]1[C@H](SCCC(=O)Nc2ccc(F)cc2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C24H32FNO5S/c1-14-4-9-19-15(2)21(32-13-11-20(27)26-17-7-5-16(25)6-8-17)28-22-24(19)18(14)10-12-23(3,29-22)30-31-24/h5-8,14-15,18-19,21-22H,4,9-13H2,1-3H3,(H,26,27)/t14-,15-,18+,19+,21+,22-,23-,24-/m1/s1 |
| InChIKey | KQRWVNRKRGOOIO-NKBQRIFNSA-N |
| XLogP | 5.10 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|