C26H35FN2O5 — CID 171358817
(4-fluorophenyl)-[4-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]piperazin-1-yl]methanone (PubChem CID 171358817) has the molecular formula C26H35FN2O5 and a molecular weight of 474.57 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171358817 |
| Molecular Formula | C26H35FN2O5 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (4-fluorophenyl)-[4-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]piperazin-1-yl]methanone |
| SMILES | C[C@H]1[C@H](N2CCN(C(=O)c3ccc(F)cc3)CC2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C26H35FN2O5/c1-16-4-9-21-17(2)23(31-24-26(21)20(16)10-11-25(3,32-24)33-34-26)29-14-12-28(13-15-29)22(30)18-5-7-19(27)8-6-18/h5-8,16-17,20-21,23-24H,4,9-15H2,1-3H3/t16-,17-,20+,21+,23-,24-,25+,26-/m1/s1 |
| InChIKey | YRANSROTSKODOH-BJBXAGGASA-N |
| XLogP | 3.79 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|