C23H28F2O7 — CID 176696890
2-[2,6-difluoro-4-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]acetic acid (PubChem CID 176696890) has the molecular formula C23H28F2O7 and a molecular weight of 454.47 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]acetic acid.
| Compound Name | 2-[2,6-difluoro-4-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 176696890 |
| Molecular Formula | C23H28F2O7 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[2,6-difluoro-4-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]acetic acid |
| SMILES | C[C@H]1[C@H](Oc2cc(F)c(CC(=O)O)c(F)c2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C23H28F2O7/c1-11-4-5-16-12(2)20(28-13-8-17(24)14(10-19(26)27)18(25)9-13)29-21-23(16)15(11)6-7-22(3,30-21)31-32-23/h8-9,11-12,15-16,20-21H,4-7,10H2,1-3H3,(H,26,27)/t11-,12-,15+,16+,20-,21-,22-,23-/m1/s1 |
| InChIKey | XKOBPZOOADPWLG-HTEBKASUSA-N |
| XLogP | 4.18 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|