C24H35NO6 — CID 164613795
3-[(dimethylamino)methyl]-5-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenol (PubChem CID 164613795) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-5-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenol.
| Compound Name | 3-[(dimethylamino)methyl]-5-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenol |
|---|---|
| PubChem CID | 164613795 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-[(dimethylamino)methyl]-5-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenol |
| SMILES | C[C@H]1[C@@H](Oc2cc(O)cc(CN(C)C)c2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C24H35NO6/c1-14-6-7-20-15(2)21(27-18-11-16(13-25(4)5)10-17(26)12-18)28-22-24(20)19(14)8-9-23(3,29-22)30-31-24/h10-12,14-15,19-22,26H,6-9,13H2,1-5H3/t14-,15-,19+,20+,21+,22-,23+,24-/m1/s1 |
| InChIKey | FYPJCJOCMVPOOE-DFAHMUSMSA-N |
| XLogP | 4.04 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|