C32H48O12S — CID 10394557
4,5-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 10394557) has the molecular formula C32H48O12S and a molecular weight of 656.79 g/mol. Its IUPAC name is 4,5-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | 4,5-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 10394557 |
| Molecular Formula | C32H48O12S |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 4,5-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | C[C@H]1[C@@H](C2OS(=O)(=O)OC2[C@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C32H48O12S/c1-15-7-9-21-17(3)23(35-27-31(21)19(15)11-13-29(5,37-27)41-43-31)25-26(40-45(33,34)39-25)24-18(4)22-10-8-16(2)20-12-14-30(6)38-28(36-24)32(20,22)44-42-30/h15-28H,7-14H2,1-6H3/t15-,16-,17-,18-,19+,20+,21+,22+,23+,24+,25?,26?,27-,28-,29+,30+,31-,32-/m1/s1 |
| InChIKey | MNIVAFFNDPDHIT-IGJCTSECSA-N |
| XLogP | 4.52 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|