C19H31NO6S — CID 58907760
4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 58907760) has the molecular formula C19H31NO6S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 58907760 |
| Molecular Formula | C19H31NO6S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](N3CCS(=O)(=O)CC3)O[C@@H]3O[C@]4(C)CC[C@@H]1C23OO4 |
| InChI | InChI=1S/C19H31NO6S/c1-12-4-5-15-13(2)16(20-8-10-27(21,22)11-9-20)23-17-19(15)14(12)6-7-18(3,24-17)25-26-19/h12-17H,4-11H2,1-3H3/t12-,13-,14+,15?,16-,17-,18+,19?/m1/s1 |
| InChIKey | FDMUNKXWYMSZIR-OLRZNPLVSA-N |
| XLogP | 1.92 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|