C30H37NO5S — CID 140678500
N-(4-phenylsulfanylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide (PubChem CID 140678500) has the molecular formula C30H37NO5S and a molecular weight of 523.70 g/mol. Its IUPAC name is N-(4-phenylsulfanylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide.
| Compound Name | N-(4-phenylsulfanylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide |
|---|---|
| PubChem CID | 140678500 |
| Molecular Formula | C30H37NO5S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | N-(4-phenylsulfanylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide |
| SMILES | C[C@H]1[C@@H](CCC(=O)Nc2ccc(Sc3ccccc3)cc2)O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C30H37NO5S/c1-19-9-14-25-20(2)26(33-28-30(25)24(19)17-18-29(3,34-28)35-36-30)15-16-27(32)31-21-10-12-23(13-11-21)37-22-7-5-4-6-8-22/h4-8,10-13,19-20,24-26,28H,9,14-18H2,1-3H3,(H,31,32)/t19-,20-,24+,25+,26-,28-,29?,30-/m1/s1 |
| InChIKey | POLPNTQVPGRAEF-UUAXWCBHSA-N |
| XLogP | 6.81 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|