C25H35NO6S — CID 140678507
N-(3-methylsulfinylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide (PubChem CID 140678507) has the molecular formula C25H35NO6S and a molecular weight of 477.62 g/mol. Its IUPAC name is N-(3-methylsulfinylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide.
| Compound Name | N-(3-methylsulfinylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide |
|---|---|
| PubChem CID | 140678507 |
| Molecular Formula | C25H35NO6S |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-(3-methylsulfinylphenyl)-3-[(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanamide |
| SMILES | C[C@H]1[C@@H](CCC(=O)Nc2cccc(S(C)=O)c2)O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H35NO6S/c1-15-8-9-20-16(2)21(10-11-22(27)26-17-6-5-7-18(14-17)33(4)28)29-23-25(20)19(15)12-13-24(3,30-23)31-32-25/h5-7,14-16,19-21,23H,8-13H2,1-4H3,(H,26,27)/t15-,16-,19+,20+,21-,23-,24?,25-,33?/m1/s1 |
| InChIKey | PKBIJBJKFNUHDW-OOMTXXQDSA-N |
| XLogP | 4.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|