C22H35NO6 — CID 166099005
N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]oxane-4-carboxamide (PubChem CID 166099005) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 166099005 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]oxane-4-carboxamide |
| SMILES | C[C@H]1[C@@H](CNC(=O)C2CCOCC2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H35NO6/c1-13-4-5-17-14(2)18(12-23-19(24)15-7-10-25-11-8-15)26-20-22(17)16(13)6-9-21(3,27-20)28-29-22/h13-18,20H,4-12H2,1-3H3,(H,23,24)/t13-,14-,16+,17+,18-,20-,21-,22-/m1/s1 |
| InChIKey | GAJHINGIDVYGTP-BIZJVOIJSA-N |
| XLogP | 2.78 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|