C30H43NO5 — CID 45487874
1-(4-benzylpiperidin-1-yl)-3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propan-1-one (PubChem CID 45487874) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propan-1-one.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propan-1-one |
|---|---|
| PubChem CID | 45487874 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propan-1-one |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](CCC(=O)N3CCC(Cc4ccccc4)CC3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C30H43NO5/c1-20-9-10-25-21(2)26(33-28-30(25)24(20)13-16-29(3,34-28)35-36-30)11-12-27(32)31-17-14-23(15-18-31)19-22-7-5-4-6-8-22/h4-8,20-21,23-26,28H,9-19H2,1-3H3/t20-,21-,24+,25?,26-,28-,29+,30-/m1/s1 |
| InChIKey | DYFZAKQEEPCNLZ-JGOSJKENSA-N |
| XLogP | 5.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|