C29H41NO7S — CID 45487868
methyl (2S)-2-[benzyl-[3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoyl]amino]-3-sulfanylpropanoate (PubChem CID 45487868) has the molecular formula C29H41NO7S and a molecular weight of 547.71 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-[3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl (2S)-2-[benzyl-[3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 45487868 |
| Molecular Formula | C29H41NO7S |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | methyl (2S)-2-[benzyl-[3-[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoyl]amino]-3-sulfanylpropanoate |
| SMILES | COC(=O)[C@@H](CS)N(Cc1ccccc1)C(=O)CC[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CCC([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C29H41NO7S/c1-18-10-11-22-19(2)24(34-27-29(22)21(18)14-15-28(3,35-27)36-37-29)12-13-25(31)30(23(17-38)26(32)33-4)16-20-8-6-5-7-9-20/h5-9,18-19,21-24,27,38H,10-17H2,1-4H3/t18-,19-,21+,22?,23-,24-,27-,28+,29-/m1/s1 |
| InChIKey | YTECTWXLJCDTEL-DOCXZMLISA-N |
| XLogP | 4.52 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|