C22H34O9S2 — CID 58607892
2-[2-[[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxycarbonyloxy]ethyldisulfanyl]ethyl acetate (PubChem CID 58607892) has the molecular formula C22H34O9S2 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[2-[[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxycarbonyloxy]ethyldisulfanyl]ethyl acetate.
| Compound Name | 2-[2-[[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxycarbonyloxy]ethyldisulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 58607892 |
| Molecular Formula | C22H34O9S2 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2-[2-[[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxycarbonyloxy]ethyldisulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSSCCOC(=O)OC1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C22H34O9S2/c1-13-5-6-17-14(2)18(28-20(24)26-10-12-33-32-11-9-25-15(3)23)27-19-22(17)16(13)7-8-21(4,29-19)30-31-22/h13-14,16-19H,5-12H2,1-4H3/t13-,14-,16+,17+,18?,19-,21+,22-/m1/s1 |
| InChIKey | ZNERMTNEENLPFX-KXONKXEQSA-N |
| XLogP | 4.29 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|