C39H53NO10 — CID 90309853
[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] benzoate (PubChem CID 90309853) has the molecular formula C39H53NO10 and a molecular weight of 695.85 g/mol. Its IUPAC name is [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] benzoate.
| Compound Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] benzoate |
|---|---|
| PubChem CID | 90309853 |
| Molecular Formula | C39H53NO10 |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.37 |
| IUPAC Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] benzoate |
| SMILES | C[C@H]1[C@@H](/C(C[C@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)=N\OC(=O)c2ccccc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C39H53NO10/c1-21-12-14-28-23(3)31(42-34-38(28)26(21)16-18-36(5,44-34)47-49-38)20-30(40-46-33(41)25-10-8-7-9-11-25)32-24(4)29-15-13-22(2)27-17-19-37(6)45-35(43-32)39(27,29)50-48-37/h7-11,21-24,26-29,31-32,34-35H,12-20H2,1-6H3/b40-30-/t21-,22-,23-,24-,26+,27+,28+,29+,31-,32+,34-,35-,36+,37+,38-,39-/m1/s1 |
| InChIKey | UTGHNIWDDQMWES-DOZARMRLSA-N |
| XLogP | 7.09 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|