C34H54N2O8 — CID 90309854
N-[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino]ethanamine (PubChem CID 90309854) has the molecular formula C34H54N2O8 and a molecular weight of 618.81 g/mol. Its IUPAC name is N-[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino]ethanamine.
| Compound Name | N-[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino]ethanamine |
|---|---|
| PubChem CID | 90309854 |
| Molecular Formula | C34H54N2O8 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.39 |
| IUPAC Name | N-[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino]ethanamine |
| SMILES | CCN/N=C(/C[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C34H54N2O8/c1-8-35-36-26(28-21(5)25-12-10-19(3)23-14-16-32(7)40-30(38-28)34(23,25)44-42-32)17-27-20(4)24-11-9-18(2)22-13-15-31(6)39-29(37-27)33(22,24)43-41-31/h18-25,27-30,35H,8-17H2,1-7H3/b36-26-/t18-,19-,20-,21-,22+,23+,24+,25+,27-,28+,29-,30-,31+,32+,33-,34-/m1/s1 |
| InChIKey | CZFYAPGTORHAPJ-NDRNZCDTSA-N |
| XLogP | 5.84 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|