C22H37NO5 — CID 166099017
1-(oxan-4-yl)-N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]methanamine (PubChem CID 166099017) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 1-(oxan-4-yl)-N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]methanamine.
| Compound Name | 1-(oxan-4-yl)-N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]methanamine |
|---|---|
| PubChem CID | 166099017 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 1-(oxan-4-yl)-N-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]methyl]methanamine |
| SMILES | C[C@H]1[C@@H](CNCC2CCOCC2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H37NO5/c1-14-4-5-18-15(2)19(13-23-12-16-7-10-24-11-8-16)25-20-22(18)17(14)6-9-21(3,26-20)27-28-22/h14-20,23H,4-13H2,1-3H3/t14-,15-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | ZZKVQRHWRBUEPJ-KUNJXQGOSA-N |
| XLogP | 3.25 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|