C35H54N2O10 — CID 77106472
[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] N,N-dimethylcarbamate (PubChem CID 77106472) has the molecular formula C35H54N2O10 and a molecular weight of 662.82 g/mol. Its IUPAC name is [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] N,N-dimethylcarbamate.
| Compound Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 77106472 |
| Molecular Formula | C35H54N2O10 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] N,N-dimethylcarbamate |
| SMILES | C[C@H]1[C@@H](/C(C[C@H]2O[C@@H]3O[C@]4(C)CCC5[C@H](C)CC[C@@H]([C@H]2C)C53OO4)=N\OC(=O)N(C)C)O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]1C42OO3 |
| InChI | InChI=1S/C35H54N2O10/c1-18-9-11-24-20(3)27(39-29-34(24)22(18)13-15-32(5,41-29)44-46-34)17-26(36-43-31(38)37(7)8)28-21(4)25-12-10-19(2)23-14-16-33(6)42-30(40-28)35(23,25)47-45-33/h18-25,27-30H,9-17H2,1-8H3/b36-26-/t18-,19-,20-,21-,22?,23?,24+,25+,27-,28+,29-,30-,32+,33+,34?,35?/m1/s1 |
| InChIKey | UCYNVBBPTPGPGJ-MYBLBEKMSA-N |
| XLogP | 5.93 |
| TPSA | 115.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|