C16H25NO6 — CID 166099008
(1R,4S,5R,8S,9R,10R,12R,13R)-N-hydroxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane-10-carboxamide (PubChem CID 166099008) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-N-hydroxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane-10-carboxamide.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-hydroxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane-10-carboxamide |
|---|---|
| PubChem CID | 166099008 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-hydroxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane-10-carboxamide |
| SMILES | C[C@H]1[C@H](C(=O)NO)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C16H25NO6/c1-8-4-5-11-9(2)12(13(18)17-19)20-14-16(11)10(8)6-7-15(3,21-14)22-23-16/h8-12,14,19H,4-7H2,1-3H3,(H,17,18)/t8-,9-,10+,11+,12-,14-,15-,16-/m1/s1 |
| InChIKey | XTLBMIHEQMCHPM-PRUZWZHBSA-N |
| XLogP | 1.74 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|