C36H57NO9 — CID 77106260
(Z)-N-(2-methylpropoxy)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine (PubChem CID 77106260) has the molecular formula C36H57NO9 and a molecular weight of 647.85 g/mol. Its IUPAC name is (Z)-N-(2-methylpropoxy)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine.
| Compound Name | (Z)-N-(2-methylpropoxy)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
|---|---|
| PubChem CID | 77106260 |
| Molecular Formula | C36H57NO9 |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.40 |
| IUPAC Name | (Z)-N-(2-methylpropoxy)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
| SMILES | CC(C)CO/N=C(/C[C@H]1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)C42OO3)[C@H]1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)C42OO3 |
| InChI | InChI=1S/C36H57NO9/c1-19(2)18-38-37-28(30-23(6)27-12-10-21(4)25-14-16-34(8)42-32(40-30)36(25,27)46-44-34)17-29-22(5)26-11-9-20(3)24-13-15-33(7)41-31(39-29)35(24,26)45-43-33/h19-27,29-32H,9-18H2,1-8H3/b37-28-/t20-,21-,22-,23-,24?,25?,26+,27+,29-,30+,31-,32-,33+,34+,35?,36?/m1/s1 |
| InChIKey | IQHOJYOCMBTFEU-WECHNZGISA-N |
| XLogP | 6.91 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|