C25H41NO7 — CID 10457300
2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl 3-piperidin-1-ylpropanoate (PubChem CID 10457300) has the molecular formula C25H41NO7 and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl 3-piperidin-1-ylpropanoate.
| Compound Name | 2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 10457300 |
| Molecular Formula | C25H41NO7 |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl 3-piperidin-1-ylpropanoate |
| SMILES | C[C@H]1[C@@H](OCCOC(=O)CCN2CCCCC2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H41NO7/c1-17-7-8-20-18(2)22(29-16-15-28-21(27)10-14-26-12-5-4-6-13-26)30-23-25(20)19(17)9-11-24(3,31-23)32-33-25/h17-20,22-23H,4-16H2,1-3H3/t17-,18-,19+,20+,22+,23-,24-,25-/m1/s1 |
| InChIKey | YTDADOMJSYLSQY-QDNCTHARSA-N |
| XLogP | 3.63 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|