C25H42N2O10 — CID 70694716
2-morpholin-4-yl-N-[2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethanamine;oxalic acid (PubChem CID 70694716) has the molecular formula C25H42N2O10 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethanamine;oxalic acid.
| Compound Name | 2-morpholin-4-yl-N-[2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 70694716 |
| Molecular Formula | C25H42N2O10 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2-morpholin-4-yl-N-[2-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]ethanamine;oxalic acid |
| SMILES | C[C@H]1[C@@H](OCCNCCN2CCOCC2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H40N2O6.C2H2O4/c1-16-4-5-19-17(2)20(27-13-9-24-8-10-25-11-14-26-15-12-25)28-21-23(19)18(16)6-7-22(3,29-21)30-31-23;3-1(4)2(5)6/h16-21,24H,4-15H2,1-3H3;(H,3,4)(H,5,6)/t16-,17-,18+,19+,20+,21-,22-,23-;/m1./s1 |
| InChIKey | HTWUUAKJHYDYMW-RURIGXLISA-N |
| XLogP | 1.29 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|