C26H40N2O4 — CID 44818633
1-[[1-methyl-5-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]piperidine (PubChem CID 44818633) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-[[1-methyl-5-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]piperidine.
| Compound Name | 1-[[1-methyl-5-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 44818633 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 1-[[1-methyl-5-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]piperidine |
| SMILES | C[C@H]1[C@H](c2ccc(CN3CCCCC3)n2C)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C26H40N2O4/c1-17-8-10-21-18(2)23(22-11-9-19(27(22)4)16-28-14-6-5-7-15-28)29-24-26(21)20(17)12-13-25(3,30-24)31-32-26/h9,11,17-18,20-21,23-24H,5-8,10,12-16H2,1-4H3/t17-,18-,20+,21+,23-,24-,25+,26-/m1/s1 |
| InChIKey | HJKVNWVGJMRCTF-MRDIVBMFSA-N |
| XLogP | 4.93 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|