C19H26O5 — CID 54075922
(1S,5R,9R,10R,12R,13R)-10-(furan-2-yl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 54075922) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1S,5R,9R,10R,12R,13R)-10-(furan-2-yl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,9R,10R,12R,13R)-10-(furan-2-yl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 54075922 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1S,5R,9R,10R,12R,13R)-10-(furan-2-yl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](c3ccco3)O[C@@H]3O[C@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C19H26O5/c1-11-6-7-14-12(2)16(15-5-4-10-20-15)21-17-19(14)13(11)8-9-18(3,22-17)23-24-19/h4-5,10-14,16-17H,6-9H2,1-3H3/t11-,12-,13?,14?,16-,17-,18+,19-/m1/s1 |
| InChIKey | MJQRBLORKZOFAJ-QHJRCUIESA-N |
| XLogP | 4.20 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|