C29H32O4 — CID 101336608
(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-phenanthren-9-yl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 101336608) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-phenanthren-9-yl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-phenanthren-9-yl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 101336608 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-phenanthren-9-yl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1[C@@H](c2cc3ccccc3c3ccccc23)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C29H32O4/c1-17-12-13-25-18(2)26(30-27-29(25)24(17)14-15-28(3,31-27)32-33-29)23-16-19-8-4-5-9-20(19)21-10-6-7-11-22(21)23/h4-11,16-18,24-27H,12-15H2,1-3H3/t17-,18-,24+,25+,26+,27-,28-,29-/m1/s1 |
| InChIKey | FJWHSKQJSAKLAC-SYSDGWSBSA-N |
| XLogP | 6.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|