C31H34O5 — CID 101093777
(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-(4-naphthalen-1-ylphenoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 101093777) has the molecular formula C31H34O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-(4-naphthalen-1-ylphenoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-(4-naphthalen-1-ylphenoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 101093777 |
| Molecular Formula | C31H34O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-(4-naphthalen-1-ylphenoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1[C@H](Oc2ccc(-c3cccc4ccccc34)cc2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C31H34O5/c1-19-11-16-27-20(2)28(33-29-31(27)26(19)17-18-30(3,34-29)35-36-31)32-23-14-12-22(13-15-23)25-10-6-8-21-7-4-5-9-24(21)25/h4-10,12-15,19-20,26-29H,11,16-18H2,1-3H3/t19-,20-,26+,27+,28-,29-,30-,31-/m1/s1 |
| InChIKey | SJCYSZQOHYQIBP-OXQMJVEVSA-N |
| XLogP | 7.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|