C25H29NO6 — CID 11812215
[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] quinoline-2-carboxylate (PubChem CID 11812215) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] quinoline-2-carboxylate.
| Compound Name | [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11812215 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] quinoline-2-carboxylate |
| SMILES | C[C@H]1[C@@H](OC(=O)c2ccc3ccccc3n2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H29NO6/c1-14-8-10-18-15(2)22(28-21(27)20-11-9-16-6-4-5-7-19(16)26-20)29-23-25(18)17(14)12-13-24(3,30-23)31-32-25/h4-7,9,11,14-15,17-18,22-23H,8,10,12-13H2,1-3H3/t14-,15-,17+,18+,22+,23-,24+,25-/m1/s1 |
| InChIKey | XLFMAMRPWYMDPG-DPZBLEEFSA-N |
| XLogP | 4.60 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|